C17H21NO4 — CID 138977811
(2R,4S,5R)-4-ethenyl-2-methyl-5-[(1R)-1-phenylmethoxyprop-2-enyl]-1,3-dioxolane-2-carboxamide (PubChem CID 138977811) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is (2R,4S,5R)-4-ethenyl-2-methyl-5-[(1R)-1-phenylmethoxyprop-2-enyl]-1,3-dioxolane-2-carboxamide.
| Compound Name | (2R,4S,5R)-4-ethenyl-2-methyl-5-[(1R)-1-phenylmethoxyprop-2-enyl]-1,3-dioxolane-2-carboxamide |
|---|---|
| PubChem CID | 138977811 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (2R,4S,5R)-4-ethenyl-2-methyl-5-[(1R)-1-phenylmethoxyprop-2-enyl]-1,3-dioxolane-2-carboxamide |
| SMILES | C=C[C@@H]1O[C@@](C)(C(N)=O)O[C@@H]1[C@@H](C=C)OCc1ccccc1 |
| InChI | InChI=1S/C17H21NO4/c1-4-13(20-11-12-9-7-6-8-10-12)15-14(5-2)21-17(3,22-15)16(18)19/h4-10,13-15H,1-2,11H2,3H3,(H2,18,19)/t13-,14+,15-,17-/m1/s1 |
| InChIKey | MRBJDWHQQZCWMD-JYYAWHABSA-N |
| XLogP | 1.93 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|