About methyl 3-[2-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]propanoate
methyl 3-[2-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]propanoate (PubChem CID 138977838) has the molecular formula C11H18O6
and a molecular weight of 246.26 g/mol. Its IUPAC name is methyl 3-[2-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]propanoate.
Analyze methyl 3-[2-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]propanoate?
The IUPAC name of methyl 3-[2-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]propanoate (CID 138977838) is methyl 3-[2-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]propanoate.
What is the SMILES notation for methyl 3-[2-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]propanoate?
The canonical SMILES for methyl 3-[2-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]propanoate is COC(=O)CCC1(CC(=O)OC)COCCO1.
What is the InChIKey of methyl 3-[2-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]propanoate?
The InChIKey is CSRKPRMASCMRCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O6/c1-14-9(12)3-4-11(7-10(13)15-2)8-16-5-6-17-11/h3-8H2,1-2H3.
What are the key properties of methyl 3-[2-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]propanoate?
methyl 3-[2-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]propanoate has a molecular weight of 246.26 g/mol, XLogP of 0.29, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]propanoate is sourced from PubChem (CID 138977838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).