C21H21FO2 — CID 138978200
ethyl (2Z,4E)-4-(3,4-dimethylphenyl)-5-(4-fluorophenyl)penta-2,4-dienoate (PubChem CID 138978200) has the molecular formula C21H21FO2 and a molecular weight of 324.40 g/mol. Its IUPAC name is ethyl (2Z,4E)-4-(3,4-dimethylphenyl)-5-(4-fluorophenyl)penta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-4-(3,4-dimethylphenyl)-5-(4-fluorophenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 138978200 |
| Molecular Formula | C21H21FO2 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | ethyl (2Z,4E)-4-(3,4-dimethylphenyl)-5-(4-fluorophenyl)penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C\C(=C/c1ccc(F)cc1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C21H21FO2/c1-4-24-21(23)12-9-19(14-17-6-10-20(22)11-7-17)18-8-5-15(2)16(3)13-18/h5-14H,4H2,1-3H3/b12-9-,19-14+ |
| InChIKey | ZCLXDAHSBGIUHP-IFNZCMHPSA-N |
| XLogP | 5.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|