C18H21IO3 — CID 138978297
(8S)-4-[2-(2-iodo-5-methoxy-4-methylphenyl)ethyl]-8-methyl-2-oxabicyclo[2.2.2]oct-5-en-3-one (PubChem CID 138978297) has the molecular formula C18H21IO3 and a molecular weight of 412.27 g/mol. Its IUPAC name is (8S)-4-[2-(2-iodo-5-methoxy-4-methylphenyl)ethyl]-8-methyl-2-oxabicyclo[2.2.2]oct-5-en-3-one.
| Compound Name | (8S)-4-[2-(2-iodo-5-methoxy-4-methylphenyl)ethyl]-8-methyl-2-oxabicyclo[2.2.2]oct-5-en-3-one |
|---|---|
| PubChem CID | 138978297 |
| Molecular Formula | C18H21IO3 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | (8S)-4-[2-(2-iodo-5-methoxy-4-methylphenyl)ethyl]-8-methyl-2-oxabicyclo[2.2.2]oct-5-en-3-one |
| SMILES | COc1cc(CCC23C=CC(C[C@@H]2C)OC3=O)c(I)cc1C |
| InChI | InChI=1S/C18H21IO3/c1-11-8-15(19)13(10-16(11)21-3)4-6-18-7-5-14(9-12(18)2)22-17(18)20/h5,7-8,10,12,14H,4,6,9H2,1-3H3/t12-,14?,18?/m0/s1 |
| InChIKey | LWXWCCMTEISGOR-DTVQEZCTSA-N |
| XLogP | 4.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|