C24H38O6 — CID 138978682
(1R,4S,8S,9R,10R,12R)-9-[2-(2,5-diethoxy-2,5-dihydrofuran-3-yl)ethyl]-9-hydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one (PubChem CID 138978682) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is (1R,4S,8S,9R,10R,12R)-9-[2-(2,5-diethoxy-2,5-dihydrofuran-3-yl)ethyl]-9-hydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one.
| Compound Name | (1R,4S,8S,9R,10R,12R)-9-[2-(2,5-diethoxy-2,5-dihydrofuran-3-yl)ethyl]-9-hydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one |
|---|---|
| PubChem CID | 138978682 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | (1R,4S,8S,9R,10R,12R)-9-[2-(2,5-diethoxy-2,5-dihydrofuran-3-yl)ethyl]-9-hydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one |
| SMILES | CCOC1C=C(CC[C@@]2(O)[C@H](C)C[C@H]3OC(=O)[C@@]4(C)CCC[C@@]2(C)[C@@H]34)C(OCC)O1 |
| InChI | InChI=1S/C24H38O6/c1-6-27-18-14-16(20(30-18)28-7-2)9-12-24(26)15(3)13-17-19-22(4,21(25)29-17)10-8-11-23(19,24)5/h14-15,17-20,26H,6-13H2,1-5H3/t15-,17-,18?,19+,20?,22+,23+,24-/m1/s1 |
| InChIKey | PQHKEPAUYKVZBB-QQUIXKDZSA-N |
| XLogP | 3.96 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|