C23H22NO2- — CID 138978999
2-(4,6-diphenyl-1,3-dihydrocyclopenta[c]furan-6-id-5-yl)-N,N-dimethylacetamide (PubChem CID 138978999) has the molecular formula C23H22NO2- and a molecular weight of 344.43 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3-dihydrocyclopenta[c]furan-6-id-5-yl)-N,N-dimethylacetamide.
| Compound Name | 2-(4,6-diphenyl-1,3-dihydrocyclopenta[c]furan-6-id-5-yl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 138978999 |
| Molecular Formula | C23H22NO2- |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-(4,6-diphenyl-1,3-dihydrocyclopenta[c]furan-6-id-5-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cc1c(-c2ccccc2)c2c([c-]1-c1ccccc1)COC2 |
| InChI | InChI=1S/C23H22NO2/c1-24(2)21(25)13-18-22(16-9-5-3-6-10-16)19-14-26-15-20(19)23(18)17-11-7-4-8-12-17/h3-12H,13-15H2,1-2H3/q-1 |
| InChIKey | FWKASDSJIJUALN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|