C32H31F3OSi2 — CID 138979072
(E)-2,3-bis[dimethyl(phenyl)silyl]-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 138979072) has the molecular formula C32H31F3OSi2 and a molecular weight of 544.77 g/mol. Its IUPAC name is (E)-2,3-bis[dimethyl(phenyl)silyl]-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-2,3-bis[dimethyl(phenyl)silyl]-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 138979072 |
| Molecular Formula | C32H31F3OSi2 |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | (E)-2,3-bis[dimethyl(phenyl)silyl]-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | C[Si](C)(/C(C(=O)c1ccc(C(F)(F)F)cc1)=C(\c1ccccc1)[Si](C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H31F3OSi2/c1-37(2,27-16-10-6-11-17-27)30(25-14-8-5-9-15-25)31(38(3,4)28-18-12-7-13-19-28)29(36)24-20-22-26(23-21-24)32(33,34)35/h5-23H,1-4H3/b31-30+ |
| InChIKey | SNSJNESTCOALCK-NVQSTNCTSA-N |
| XLogP | 7.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|