C20H16BrFO3 — CID 138979304
methyl (1R,2S)-2-(4-bromophenyl)-1-fluoro-4-methyl-5-oxo-3-phenylcyclopent-3-ene-1-carboxylate (PubChem CID 138979304) has the molecular formula C20H16BrFO3 and a molecular weight of 403.25 g/mol. Its IUPAC name is methyl (1R,2S)-2-(4-bromophenyl)-1-fluoro-4-methyl-5-oxo-3-phenylcyclopent-3-ene-1-carboxylate.
| Compound Name | methyl (1R,2S)-2-(4-bromophenyl)-1-fluoro-4-methyl-5-oxo-3-phenylcyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 138979304 |
| Molecular Formula | C20H16BrFO3 |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | methyl (1R,2S)-2-(4-bromophenyl)-1-fluoro-4-methyl-5-oxo-3-phenylcyclopent-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(F)C(=O)C(C)=C(c2ccccc2)[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H16BrFO3/c1-12-16(13-6-4-3-5-7-13)17(14-8-10-15(21)11-9-14)20(22,18(12)23)19(24)25-2/h3-11,17H,1-2H3/t17-,20+/m0/s1 |
| InChIKey | QWDUWHBWBSTPGZ-FXAWDEMLSA-N |
| XLogP | 4.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|