C36H41NO4 — CID 138979334
[(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 6-methoxy-4-phenylquinoline-2-carboxylate (PubChem CID 138979334) has the molecular formula C36H41NO4 and a molecular weight of 551.73 g/mol. Its IUPAC name is [(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 6-methoxy-4-phenylquinoline-2-carboxylate.
| Compound Name | [(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 6-methoxy-4-phenylquinoline-2-carboxylate |
|---|---|
| PubChem CID | 138979334 |
| Molecular Formula | C36H41NO4 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | [(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 6-methoxy-4-phenylquinoline-2-carboxylate |
| SMILES | COc1ccc2nc(C(=O)O[C@H]3CC[C@@]4(C)[C@@H](CC[C@@H]5[C@@H]4CC[C@]4(C)C(=O)CC[C@@H]54)C3)cc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C36H41NO4/c1-35-17-15-25(19-23(35)9-11-26-29-12-14-33(38)36(29,2)18-16-30(26)35)41-34(39)32-21-27(22-7-5-4-6-8-22)28-20-24(40-3)10-13-31(28)37-32/h4-8,10,13,20-21,23,25-26,29-30H,9,11-12,14-19H2,1-3H3/t23-,25-,26-,29-,30-,35-,36-/m0/s1 |
| InChIKey | JQXOZUYJUWQIKP-WIRFIEECSA-N |
| XLogP | 8.05 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |