About (3S)-3-propan-2-yl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole
(3S)-3-propan-2-yl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole (PubChem CID 138979401) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is (3S)-3-propan-2-yl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | (3S)-3-propan-2-yl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole |
| PubChem CID | 138979401 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (3S)-3-propan-2-yl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole |
| SMILES | CC(C)[C@@H]1CCn2c1nc1ccccc12 |
| InChI | InChI=1S/C13H16N2/c1-9(2)10-7-8-15-12-6-4-3-5-11(12)14-13(10)15/h3-6,9-10H,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | ZBDJYFXKKVSSCV-JTQLQIEISA-N |
| XLogP | 3.18 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-propan-2-yl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-propan-2-yl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole?
The IUPAC name of (3S)-3-propan-2-yl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole (CID 138979401) is (3S)-3-propan-2-yl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole.
What is the SMILES notation for (3S)-3-propan-2-yl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole?
The canonical SMILES for (3S)-3-propan-2-yl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole is CC(C)[C@@H]1CCn2c1nc1ccccc12.
What is the InChIKey of (3S)-3-propan-2-yl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole?
The InChIKey is ZBDJYFXKKVSSCV-JTQLQIEISA-N. The full InChI is InChI=1S/C13H16N2/c1-9(2)10-7-8-15-12-6-4-3-5-11(12)14-13(10)15/h3-6,9-10H,7-8H2,1-2H3/t10-/m0/s1.
What are the key properties of (3S)-3-propan-2-yl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole?
(3S)-3-propan-2-yl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole has a molecular weight of 200.28 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-propan-2-yl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole is sourced from PubChem (CID 138979401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).