About [(1R,2S)-2-(2-cyclopenta-1,4-dien-1-ylethynyl)-1-methylcyclopropyl]benzene
[(1R,2S)-2-(2-cyclopenta-1,4-dien-1-ylethynyl)-1-methylcyclopropyl]benzene (PubChem CID 138979412) has the molecular formula C17H16
and a molecular weight of 220.31 g/mol. Its IUPAC name is [(1R,2S)-2-(2-cyclopenta-1,4-dien-1-ylethynyl)-1-methylcyclopropyl]benzene.
Molecular Properties
| Compound Name | [(1R,2S)-2-(2-cyclopenta-1,4-dien-1-ylethynyl)-1-methylcyclopropyl]benzene |
| PubChem CID | 138979412 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | [(1R,2S)-2-(2-cyclopenta-1,4-dien-1-ylethynyl)-1-methylcyclopropyl]benzene |
| SMILES | C[C@@]1(c2ccccc2)C[C@H]1C#CC1=CCC=C1 |
| InChI | InChI=1S/C17H16/c1-17(15-9-3-2-4-10-15)13-16(17)12-11-14-7-5-6-8-14/h2-5,7-10,16H,6,13H2,1H3/t16-,17+/m1/s1 |
| InChIKey | TVUTVMNTSJZOKE-SJORKVTESA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S)-2-(2-cyclopenta-1,4-dien-1-ylethynyl)-1-methylcyclopropyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-(2-cyclopenta-1,4-dien-1-ylethynyl)-1-methylcyclopropyl]benzene?
The IUPAC name of [(1R,2S)-2-(2-cyclopenta-1,4-dien-1-ylethynyl)-1-methylcyclopropyl]benzene (CID 138979412) is [(1R,2S)-2-(2-cyclopenta-1,4-dien-1-ylethynyl)-1-methylcyclopropyl]benzene.
What is the SMILES notation for [(1R,2S)-2-(2-cyclopenta-1,4-dien-1-ylethynyl)-1-methylcyclopropyl]benzene?
The canonical SMILES for [(1R,2S)-2-(2-cyclopenta-1,4-dien-1-ylethynyl)-1-methylcyclopropyl]benzene is C[C@@]1(c2ccccc2)C[C@H]1C#CC1=CCC=C1.
What is the InChIKey of [(1R,2S)-2-(2-cyclopenta-1,4-dien-1-ylethynyl)-1-methylcyclopropyl]benzene?
The InChIKey is TVUTVMNTSJZOKE-SJORKVTESA-N. The full InChI is InChI=1S/C17H16/c1-17(15-9-3-2-4-10-15)13-16(17)12-11-14-7-5-6-8-14/h2-5,7-10,16H,6,13H2,1H3/t16-,17+/m1/s1.
What are the key properties of [(1R,2S)-2-(2-cyclopenta-1,4-dien-1-ylethynyl)-1-methylcyclopropyl]benzene?
[(1R,2S)-2-(2-cyclopenta-1,4-dien-1-ylethynyl)-1-methylcyclopropyl]benzene has a molecular weight of 220.31 g/mol, XLogP of 3.85, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-(2-cyclopenta-1,4-dien-1-ylethynyl)-1-methylcyclopropyl]benzene is sourced from PubChem (CID 138979412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).