About 5,6-dihydroimidazo[1,2-d][1,4]benzothiazepine
5,6-dihydroimidazo[1,2-d][1,4]benzothiazepine (PubChem CID 138979417) has the molecular formula C11H10N2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 5,6-dihydroimidazo[1,2-d][1,4]benzothiazepine.
Molecular Properties
| Compound Name | 5,6-dihydroimidazo[1,2-d][1,4]benzothiazepine |
| PubChem CID | 138979417 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 5,6-dihydroimidazo[1,2-d][1,4]benzothiazepine |
| SMILES | c1ccc2c(c1)SCCn1ccnc1-2 |
| InChI | InChI=1S/C11H10N2S/c1-2-4-10-9(3-1)11-12-5-6-13(11)7-8-14-10/h1-6H,7-8H2 |
| InChIKey | NBWABBFMFGXSJX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dihydroimidazo[1,2-d][1,4]benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydroimidazo[1,2-d][1,4]benzothiazepine?
The IUPAC name of 5,6-dihydroimidazo[1,2-d][1,4]benzothiazepine (CID 138979417) is 5,6-dihydroimidazo[1,2-d][1,4]benzothiazepine.
What is the SMILES notation for 5,6-dihydroimidazo[1,2-d][1,4]benzothiazepine?
The canonical SMILES for 5,6-dihydroimidazo[1,2-d][1,4]benzothiazepine is c1ccc2c(c1)SCCn1ccnc1-2.
What is the InChIKey of 5,6-dihydroimidazo[1,2-d][1,4]benzothiazepine?
The InChIKey is NBWABBFMFGXSJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2S/c1-2-4-10-9(3-1)11-12-5-6-13(11)7-8-14-10/h1-6H,7-8H2.
What are the key properties of 5,6-dihydroimidazo[1,2-d][1,4]benzothiazepine?
5,6-dihydroimidazo[1,2-d][1,4]benzothiazepine has a molecular weight of 202.28 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydroimidazo[1,2-d][1,4]benzothiazepine is sourced from PubChem (CID 138979417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).