About benzyl N-[(2R)-4,4,4-trifluoro-1-phenylbutan-2-yl]carbamate
benzyl N-[(2R)-4,4,4-trifluoro-1-phenylbutan-2-yl]carbamate (PubChem CID 138979468) has the molecular formula C18H18F3NO2
and a molecular weight of 337.34 g/mol. Its IUPAC name is benzyl N-[(2R)-4,4,4-trifluoro-1-phenylbutan-2-yl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[(2R)-4,4,4-trifluoro-1-phenylbutan-2-yl]carbamate |
| PubChem CID | 138979468 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | benzyl N-[(2R)-4,4,4-trifluoro-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C(N[C@H](Cc1ccccc1)CC(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C18H18F3NO2/c19-18(20,21)12-16(11-14-7-3-1-4-8-14)22-17(23)24-13-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,22,23)/t16-/m1/s1 |
| InChIKey | PSHCHNLOPMJWME-MRXNPFEDSA-N |
| XLogP | 4.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl N-[(2R)-4,4,4-trifluoro-1-phenylbutan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[(2R)-4,4,4-trifluoro-1-phenylbutan-2-yl]carbamate?
The IUPAC name of benzyl N-[(2R)-4,4,4-trifluoro-1-phenylbutan-2-yl]carbamate (CID 138979468) is benzyl N-[(2R)-4,4,4-trifluoro-1-phenylbutan-2-yl]carbamate.
What is the SMILES notation for benzyl N-[(2R)-4,4,4-trifluoro-1-phenylbutan-2-yl]carbamate?
The canonical SMILES for benzyl N-[(2R)-4,4,4-trifluoro-1-phenylbutan-2-yl]carbamate is O=C(N[C@H](Cc1ccccc1)CC(F)(F)F)OCc1ccccc1.
What is the InChIKey of benzyl N-[(2R)-4,4,4-trifluoro-1-phenylbutan-2-yl]carbamate?
The InChIKey is PSHCHNLOPMJWME-MRXNPFEDSA-N. The full InChI is InChI=1S/C18H18F3NO2/c19-18(20,21)12-16(11-14-7-3-1-4-8-14)22-17(23)24-13-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,22,23)/t16-/m1/s1.
What are the key properties of benzyl N-[(2R)-4,4,4-trifluoro-1-phenylbutan-2-yl]carbamate?
benzyl N-[(2R)-4,4,4-trifluoro-1-phenylbutan-2-yl]carbamate has a molecular weight of 337.34 g/mol, XLogP of 4.48, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(2R)-4,4,4-trifluoro-1-phenylbutan-2-yl]carbamate is sourced from PubChem (CID 138979468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).