C12H15NO2 — CID 138979506
(1R,2R,4S,5S)-2-ethenyl-4-[(E)-3-oxobut-1-enyl]-6-azabicyclo[3.2.0]heptan-7-one (PubChem CID 138979506) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (1R,2R,4S,5S)-2-ethenyl-4-[(E)-3-oxobut-1-enyl]-6-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (1R,2R,4S,5S)-2-ethenyl-4-[(E)-3-oxobut-1-enyl]-6-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 138979506 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (1R,2R,4S,5S)-2-ethenyl-4-[(E)-3-oxobut-1-enyl]-6-azabicyclo[3.2.0]heptan-7-one |
| SMILES | C=C[C@H]1C[C@@H](/C=C/C(C)=O)[C@@H]2NC(=O)[C@@H]21 |
| InChI | InChI=1S/C12H15NO2/c1-3-8-6-9(5-4-7(2)14)11-10(8)12(15)13-11/h3-5,8-11H,1,6H2,2H3,(H,13,15)/b5-4+/t8-,9+,10+,11-/m0/s1 |
| InChIKey | ZYCKFNKRSCZOSS-JPEXKCLGSA-N |
| XLogP | 1.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|