About (3R)-5-fluoro-1,3-dimethyl-3-(nitromethyl)quinoline-2,4-dione
(3R)-5-fluoro-1,3-dimethyl-3-(nitromethyl)quinoline-2,4-dione (PubChem CID 138979519) has the molecular formula C12H11FN2O4
and a molecular weight of 266.23 g/mol. Its IUPAC name is (3R)-5-fluoro-1,3-dimethyl-3-(nitromethyl)quinoline-2,4-dione.
Molecular Properties
| Compound Name | (3R)-5-fluoro-1,3-dimethyl-3-(nitromethyl)quinoline-2,4-dione |
| PubChem CID | 138979519 |
| Molecular Formula | C12H11FN2O4 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (3R)-5-fluoro-1,3-dimethyl-3-(nitromethyl)quinoline-2,4-dione |
| SMILES | CN1C(=O)[C@](C)(C[N+](=O)[O-])C(=O)c2c(F)cccc21 |
| InChI | InChI=1S/C12H11FN2O4/c1-12(6-15(18)19)10(16)9-7(13)4-3-5-8(9)14(2)11(12)17/h3-5H,6H2,1-2H3/t12-/m1/s1 |
| InChIKey | KMJYQRYHZHPYKI-GFCCVEGCSA-N |
| XLogP | 1.27 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-5-fluoro-1,3-dimethyl-3-(nitromethyl)quinoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5-fluoro-1,3-dimethyl-3-(nitromethyl)quinoline-2,4-dione?
The IUPAC name of (3R)-5-fluoro-1,3-dimethyl-3-(nitromethyl)quinoline-2,4-dione (CID 138979519) is (3R)-5-fluoro-1,3-dimethyl-3-(nitromethyl)quinoline-2,4-dione.
What is the SMILES notation for (3R)-5-fluoro-1,3-dimethyl-3-(nitromethyl)quinoline-2,4-dione?
The canonical SMILES for (3R)-5-fluoro-1,3-dimethyl-3-(nitromethyl)quinoline-2,4-dione is CN1C(=O)[C@](C)(C[N+](=O)[O-])C(=O)c2c(F)cccc21.
What is the InChIKey of (3R)-5-fluoro-1,3-dimethyl-3-(nitromethyl)quinoline-2,4-dione?
The InChIKey is KMJYQRYHZHPYKI-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H11FN2O4/c1-12(6-15(18)19)10(16)9-7(13)4-3-5-8(9)14(2)11(12)17/h3-5H,6H2,1-2H3/t12-/m1/s1.
What are the key properties of (3R)-5-fluoro-1,3-dimethyl-3-(nitromethyl)quinoline-2,4-dione?
(3R)-5-fluoro-1,3-dimethyl-3-(nitromethyl)quinoline-2,4-dione has a molecular weight of 266.23 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-fluoro-1,3-dimethyl-3-(nitromethyl)quinoline-2,4-dione is sourced from PubChem (CID 138979519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).