C31H58O7Si — CID 138979853
methyl (5S,6E,8S,9R,11Z)-9-(1-acetyloxyethyl)-5-[tert-butyl(dimethyl)silyl]oxy-8-(dimethoxymethyl)heptadeca-6,11-dienoate (PubChem CID 138979853) has the molecular formula C31H58O7Si and a molecular weight of 570.88 g/mol. Its IUPAC name is methyl (5S,6E,8S,9R,11Z)-9-(1-acetyloxyethyl)-5-[tert-butyl(dimethyl)silyl]oxy-8-(dimethoxymethyl)heptadeca-6,11-dienoate.
| Compound Name | methyl (5S,6E,8S,9R,11Z)-9-(1-acetyloxyethyl)-5-[tert-butyl(dimethyl)silyl]oxy-8-(dimethoxymethyl)heptadeca-6,11-dienoate |
|---|---|
| PubChem CID | 138979853 |
| Molecular Formula | C31H58O7Si |
| Molecular Weight | 570.88 g/mol |
| Exact Mass | 570.40 |
| IUPAC Name | methyl (5S,6E,8S,9R,11Z)-9-(1-acetyloxyethyl)-5-[tert-butyl(dimethyl)silyl]oxy-8-(dimethoxymethyl)heptadeca-6,11-dienoate |
| SMILES | CCCCC/C=C\C[C@@H](C(C)OC(C)=O)[C@H](/C=C/[C@H](CCCC(=O)OC)O[Si](C)(C)C(C)(C)C)C(OC)OC |
| InChI | InChI=1S/C31H58O7Si/c1-12-13-14-15-16-17-20-27(24(2)37-25(3)32)28(30(35-8)36-9)23-22-26(19-18-21-29(33)34-7)38-39(10,11)31(4,5)6/h16-17,22-24,26-28,30H,12-15,18-21H2,1-11H3/b17-16-,23-22+/t24?,26-,27-,28-/m0/s1 |
| InChIKey | YDCPVZYSJMOIFC-SJQACFJFSA-N |
| XLogP | 7.61 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.88 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|