C15H24N2O — CID 138979891
1,3-diethyl-1-(4-phenylbutyl)urea (PubChem CID 138979891) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 1,3-diethyl-1-(4-phenylbutyl)urea.
| Compound Name | 1,3-diethyl-1-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 138979891 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1,3-diethyl-1-(4-phenylbutyl)urea |
| SMILES | CCNC(=O)N(CC)CCCCc1ccccc1 |
| InChI | InChI=1S/C15H24N2O/c1-3-16-15(18)17(4-2)13-9-8-12-14-10-6-5-7-11-14/h5-7,10-11H,3-4,8-9,12-13H2,1-2H3,(H,16,18) |
| InChIKey | CFYYOEOBSWQQDQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|