C12H8Br2O3 — CID 138979900
methyl (1R)-1,7-dibromo-2-oxonaphthalene-1-carboxylate (PubChem CID 138979900) has the molecular formula C12H8Br2O3 and a molecular weight of 360.00 g/mol. Its IUPAC name is methyl (1R)-1,7-dibromo-2-oxonaphthalene-1-carboxylate.
| Compound Name | methyl (1R)-1,7-dibromo-2-oxonaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 138979900 |
| Molecular Formula | C12H8Br2O3 |
| Molecular Weight | 360.00 g/mol |
| Exact Mass | 357.88 |
| IUPAC Name | methyl (1R)-1,7-dibromo-2-oxonaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@]1(Br)C(=O)C=Cc2ccc(Br)cc21 |
| InChI | InChI=1S/C12H8Br2O3/c1-17-11(16)12(14)9-6-8(13)4-2-7(9)3-5-10(12)15/h2-6H,1H3/t12-/m1/s1 |
| InChIKey | ZWAQGJWXKKVSBF-GFCCVEGCSA-N |
| XLogP | 2.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.00 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|