C18H28O3Si — CID 138979965
(Z)-3-[(1S,2R)-2-ethenyl-1,3-dimethyl-4-trimethylsilyloxycyclohex-3-en-1-yl]-4-oxopent-2-enal (PubChem CID 138979965) has the molecular formula C18H28O3Si and a molecular weight of 320.51 g/mol. Its IUPAC name is (Z)-3-[(1S,2R)-2-ethenyl-1,3-dimethyl-4-trimethylsilyloxycyclohex-3-en-1-yl]-4-oxopent-2-enal.
| Compound Name | (Z)-3-[(1S,2R)-2-ethenyl-1,3-dimethyl-4-trimethylsilyloxycyclohex-3-en-1-yl]-4-oxopent-2-enal |
|---|---|
| PubChem CID | 138979965 |
| Molecular Formula | C18H28O3Si |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (Z)-3-[(1S,2R)-2-ethenyl-1,3-dimethyl-4-trimethylsilyloxycyclohex-3-en-1-yl]-4-oxopent-2-enal |
| SMILES | C=C[C@H]1C(C)=C(O[Si](C)(C)C)CC[C@]1(C)/C(=C/C=O)C(C)=O |
| InChI | InChI=1S/C18H28O3Si/c1-8-15-13(2)17(21-22(5,6)7)9-11-18(15,4)16(10-12-19)14(3)20/h8,10,12,15H,1,9,11H2,2-7H3/b16-10+/t15-,18-/m0/s1 |
| InChIKey | WQWOVONQQKSAKY-RDKGUXCJSA-N |
| XLogP | 4.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|