C20H16F26NO+ — CID 138979986
4,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)morpholin-4-ium (PubChem CID 138979986) has the molecular formula C20H16F26NO+ and a molecular weight of 780.30 g/mol. Its IUPAC name is 4,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)morpholin-4-ium.
| Compound Name | 4,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)morpholin-4-ium |
|---|---|
| PubChem CID | 138979986 |
| Molecular Formula | C20H16F26NO+ |
| Molecular Weight | 780.30 g/mol |
| Exact Mass | 780.08 |
| IUPAC Name | 4,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)morpholin-4-ium |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[N+]1(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCOCC1 |
| InChI | InChI=1S/C20H16F26NO/c21-9(22,11(25,26)13(29,30)15(33,34)17(37,38)19(41,42)43)1-3-47(5-7-48-8-6-47)4-2-10(23,24)12(27,28)14(31,32)16(35,36)18(39,40)20(44,45)46/h1-8H2/q+1 |
| InChIKey | YGRSLKCBFPNDIP-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.30 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|