C19H28O — CID 138980039
(1R,3aR,4R,6aS)-4-ethynyl-5-methoxy-4,6a-dimethyl-1-propan-2-yl-3a-prop-2-enyl-2,3-dihydro-1H-pentalene (PubChem CID 138980039) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is (1R,3aR,4R,6aS)-4-ethynyl-5-methoxy-4,6a-dimethyl-1-propan-2-yl-3a-prop-2-enyl-2,3-dihydro-1H-pentalene.
| Compound Name | (1R,3aR,4R,6aS)-4-ethynyl-5-methoxy-4,6a-dimethyl-1-propan-2-yl-3a-prop-2-enyl-2,3-dihydro-1H-pentalene |
|---|---|
| PubChem CID | 138980039 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (1R,3aR,4R,6aS)-4-ethynyl-5-methoxy-4,6a-dimethyl-1-propan-2-yl-3a-prop-2-enyl-2,3-dihydro-1H-pentalene |
| SMILES | C#C[C@@]1(C)C(OC)=C[C@]2(C)[C@@H](C(C)C)CC[C@]12CC=C |
| InChI | InChI=1S/C19H28O/c1-8-11-19-12-10-15(14(3)4)18(19,6)13-16(20-7)17(19,5)9-2/h2,8,13-15H,1,10-12H2,3-7H3/t15-,17+,18-,19-/m1/s1 |
| InChIKey | NCIDDXSDSSPCDX-QXCFHYIPSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|