C34H51N5O6Si — CID 138980072
tert-butyl N-[N'-[(4R)-4-acetamido-4-[[(2S)-2-methyl-3-(methylamino)-3-oxopropyl]-diphenylsilyl]butyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 138980072) has the molecular formula C34H51N5O6Si and a molecular weight of 653.90 g/mol. Its IUPAC name is tert-butyl N-[N'-[(4R)-4-acetamido-4-[[(2S)-2-methyl-3-(methylamino)-3-oxopropyl]-diphenylsilyl]butyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[(4R)-4-acetamido-4-[[(2S)-2-methyl-3-(methylamino)-3-oxopropyl]-diphenylsilyl]butyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 138980072 |
| Molecular Formula | C34H51N5O6Si |
| Molecular Weight | 653.90 g/mol |
| Exact Mass | 653.36 |
| IUPAC Name | tert-butyl N-[N'-[(4R)-4-acetamido-4-[[(2S)-2-methyl-3-(methylamino)-3-oxopropyl]-diphenylsilyl]butyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CNC(=O)[C@H](C)C[Si](c1ccccc1)(c1ccccc1)[C@H](CCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)NC(C)=O |
| InChI | InChI=1S/C34H51N5O6Si/c1-24(29(41)35-9)23-46(26-17-12-10-13-18-26,27-19-14-11-15-20-27)28(37-25(2)40)21-16-22-36-30(38-31(42)44-33(3,4)5)39-32(43)45-34(6,7)8/h10-15,17-20,24,28H,16,21-23H2,1-9H3,(H,35,41)(H,37,40)(H2,36,38,39,42,43)/t24-,28-/m1/s1 |
| InChIKey | VHOAPVBZNCSYSN-UFHPHHKVSA-N |
| XLogP | 3.86 |
| TPSA | 147.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.90 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|