About 8a-methoxy-2-methyl-5,6,7,8-tetrahydroindolizin-3-one
8a-methoxy-2-methyl-5,6,7,8-tetrahydroindolizin-3-one (PubChem CID 138980111) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 8a-methoxy-2-methyl-5,6,7,8-tetrahydroindolizin-3-one.
Analyze 8a-methoxy-2-methyl-5,6,7,8-tetrahydroindolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8a-methoxy-2-methyl-5,6,7,8-tetrahydroindolizin-3-one?
The IUPAC name of 8a-methoxy-2-methyl-5,6,7,8-tetrahydroindolizin-3-one (CID 138980111) is 8a-methoxy-2-methyl-5,6,7,8-tetrahydroindolizin-3-one.
What is the SMILES notation for 8a-methoxy-2-methyl-5,6,7,8-tetrahydroindolizin-3-one?
The canonical SMILES for 8a-methoxy-2-methyl-5,6,7,8-tetrahydroindolizin-3-one is COC12C=C(C)C(=O)N1CCCC2.
What is the InChIKey of 8a-methoxy-2-methyl-5,6,7,8-tetrahydroindolizin-3-one?
The InChIKey is DOUHGUNUBIWXFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-8-7-10(13-2)5-3-4-6-11(10)9(8)12/h7H,3-6H2,1-2H3.
What are the key properties of 8a-methoxy-2-methyl-5,6,7,8-tetrahydroindolizin-3-one?
8a-methoxy-2-methyl-5,6,7,8-tetrahydroindolizin-3-one has a molecular weight of 181.23 g/mol, XLogP of 1.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8a-methoxy-2-methyl-5,6,7,8-tetrahydroindolizin-3-one is sourced from PubChem (CID 138980111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).