C20H18FNO3 — CID 138980178
methyl (Z)-2-[(3-fluoro-1-methyl-2-oxoindol-3-yl)methyl]-3-phenylprop-2-enoate (PubChem CID 138980178) has the molecular formula C20H18FNO3 and a molecular weight of 339.37 g/mol. Its IUPAC name is methyl (Z)-2-[(3-fluoro-1-methyl-2-oxoindol-3-yl)methyl]-3-phenylprop-2-enoate.
| Compound Name | methyl (Z)-2-[(3-fluoro-1-methyl-2-oxoindol-3-yl)methyl]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 138980178 |
| Molecular Formula | C20H18FNO3 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | methyl (Z)-2-[(3-fluoro-1-methyl-2-oxoindol-3-yl)methyl]-3-phenylprop-2-enoate |
| SMILES | COC(=O)/C(=C\c1ccccc1)CC1(F)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C20H18FNO3/c1-22-17-11-7-6-10-16(17)20(21,19(22)24)13-15(18(23)25-2)12-14-8-4-3-5-9-14/h3-12H,13H2,1-2H3/b15-12- |
| InChIKey | KYVSAGZVGVFOEQ-QINSGFPZSA-N |
| XLogP | 3.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|