C46H24Cl4I2 — CID 138980258
5,12-bis(2,6-dichlorophenyl)-6,13-diiodo-1,8-diphenylnaphtho[1,2-b]phenanthrene (PubChem CID 138980258) has the molecular formula C46H24Cl4I2 and a molecular weight of 972.32 g/mol. Its IUPAC name is 5,12-bis(2,6-dichlorophenyl)-6,13-diiodo-1,8-diphenylnaphtho[1,2-b]phenanthrene.
| Compound Name | 5,12-bis(2,6-dichlorophenyl)-6,13-diiodo-1,8-diphenylnaphtho[1,2-b]phenanthrene |
|---|---|
| PubChem CID | 138980258 |
| Molecular Formula | C46H24Cl4I2 |
| Molecular Weight | 972.32 g/mol |
| Exact Mass | 969.87 |
| IUPAC Name | 5,12-bis(2,6-dichlorophenyl)-6,13-diiodo-1,8-diphenylnaphtho[1,2-b]phenanthrene |
| SMILES | Clc1cccc(Cl)c1-c1c(I)c2cc3c(cc2c2c(-c4ccccc4)cccc12)c(I)c(-c1c(Cl)cccc1Cl)c1cccc(-c2ccccc2)c13 |
| InChI | InChI=1S/C46H24Cl4I2/c47-35-19-9-20-36(48)43(35)41-29-17-7-15-27(25-11-3-1-4-12-25)39(29)31-23-34-32(24-33(31)45(41)51)40-28(26-13-5-2-6-14-26)16-8-18-30(40)42(46(34)52)44-37(49)21-10-22-38(44)50/h1-24H |
| InChIKey | TYGFSETWTAUWIB-UHFFFAOYSA-N |
| XLogP | 16.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.32 |
| LogP ≤ 5 | 16.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|