C27H42O4Si — CID 138980362
methyl (3R,3aR,5aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-6-oxo-1-propan-2-yl-3,4,5,7-tetrahydro-2H-cyclohepta[e]indene-8-carboxylate (PubChem CID 138980362) has the molecular formula C27H42O4Si and a molecular weight of 458.72 g/mol. Its IUPAC name is methyl (3R,3aR,5aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-6-oxo-1-propan-2-yl-3,4,5,7-tetrahydro-2H-cyclohepta[e]indene-8-carboxylate.
| Compound Name | methyl (3R,3aR,5aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-6-oxo-1-propan-2-yl-3,4,5,7-tetrahydro-2H-cyclohepta[e]indene-8-carboxylate |
|---|---|
| PubChem CID | 138980362 |
| Molecular Formula | C27H42O4Si |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | methyl (3R,3aR,5aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-6-oxo-1-propan-2-yl-3,4,5,7-tetrahydro-2H-cyclohepta[e]indene-8-carboxylate |
| SMILES | COC(=O)C1=CC=C2C3=C(C(C)C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@]3(C)CC[C@@]2(C)C(=O)C1 |
| InChI | InChI=1S/C27H42O4Si/c1-17(2)19-16-22(31-32(9,10)25(3,4)5)27(7)14-13-26(6)20(23(19)27)12-11-18(15-21(26)28)24(29)30-8/h11-12,17,22H,13-16H2,1-10H3/t22-,26-,27+/m1/s1 |
| InChIKey | SAVZRYNEFWQEKQ-XCRWMPKNSA-N |
| XLogP | 6.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|