C19H27F3O5 — CID 138980396
2,3-dimethoxy-5-methyl-6-[9-(trifluoromethoxy)nonyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 138980396) has the molecular formula C19H27F3O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-[9-(trifluoromethoxy)nonyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethoxy-5-methyl-6-[9-(trifluoromethoxy)nonyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 138980396 |
| Molecular Formula | C19H27F3O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[9-(trifluoromethoxy)nonyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCCOC(F)(F)F)=C(C)C1=O |
| InChI | InChI=1S/C19H27F3O5/c1-13-14(16(24)18(26-3)17(25-2)15(13)23)11-9-7-5-4-6-8-10-12-27-19(20,21)22/h4-12H2,1-3H3 |
| InChIKey | UPTOACCFLRGRJN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|