C23H38O5Si — CID 138980418
prop-2-enyl (3aR,4S,7R,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a-ethenyl-4-methoxy-3-oxo-2,4,5,6,7,7a-hexahydro-1H-indene-2-carboxylate (PubChem CID 138980418) has the molecular formula C23H38O5Si and a molecular weight of 422.64 g/mol. Its IUPAC name is prop-2-enyl (3aR,4S,7R,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a-ethenyl-4-methoxy-3-oxo-2,4,5,6,7,7a-hexahydro-1H-indene-2-carboxylate.
| Compound Name | prop-2-enyl (3aR,4S,7R,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a-ethenyl-4-methoxy-3-oxo-2,4,5,6,7,7a-hexahydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 138980418 |
| Molecular Formula | C23H38O5Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | prop-2-enyl (3aR,4S,7R,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a-ethenyl-4-methoxy-3-oxo-2,4,5,6,7,7a-hexahydro-1H-indene-2-carboxylate |
| SMILES | C=CCOC(=O)C1C[C@@H]2[C@H](CO[Si](C)(C)C(C)(C)C)CC[C@H](OC)[C@]2(C=C)C1=O |
| InChI | InChI=1S/C23H38O5Si/c1-9-13-27-21(25)17-14-18-16(15-28-29(7,8)22(3,4)5)11-12-19(26-6)23(18,10-2)20(17)24/h9-10,16-19H,1-2,11-15H2,3-8H3/t16-,17?,18+,19-,23+/m0/s1 |
| InChIKey | HASWAGRMJKYFMA-BRMSFHTHSA-N |
| XLogP | 4.54 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|