About (2R,5S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol
(2R,5S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol (PubChem CID 138980438) has the molecular formula C8H16O5
and a molecular weight of 192.21 g/mol. Its IUPAC name is (2R,5S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol.
Molecular Properties
| Compound Name | (2R,5S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol |
| PubChem CID | 138980438 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (2R,5S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol |
| SMILES | CO[C@@H]1OC(CO)[C@@H](C)C(O)C1O |
| InChI | InChI=1S/C8H16O5/c1-4-5(3-9)13-8(12-2)7(11)6(4)10/h4-11H,3H2,1-2H3/t4-,5?,6?,7?,8-/m1/s1 |
| InChIKey | QEMAHOAOSMCXJQ-YVKWHVBHSA-N |
| XLogP | -1.29 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R,5S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol?
The IUPAC name of (2R,5S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol (CID 138980438) is (2R,5S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol.
What is the SMILES notation for (2R,5S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol?
The canonical SMILES for (2R,5S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol is CO[C@@H]1OC(CO)[C@@H](C)C(O)C1O.
What is the InChIKey of (2R,5S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol?
The InChIKey is QEMAHOAOSMCXJQ-YVKWHVBHSA-N. The full InChI is InChI=1S/C8H16O5/c1-4-5(3-9)13-8(12-2)7(11)6(4)10/h4-11H,3H2,1-2H3/t4-,5?,6?,7?,8-/m1/s1.
What are the key properties of (2R,5S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol?
(2R,5S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol has a molecular weight of 192.21 g/mol, XLogP of -1.29, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-6-(hydroxymethyl)-2-methoxy-5-methyloxane-3,4-diol is sourced from PubChem (CID 138980438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).