C39H76O3Si3 — CID 138980514
(E,8R,10S,13S,14R)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-16-tri(propan-2-yl)silylhexadec-11-en-2,15-diyn-4-ol (PubChem CID 138980514) has the molecular formula C39H76O3Si3 and a molecular weight of 677.29 g/mol. Its IUPAC name is (E,8R,10S,13S,14R)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-16-tri(propan-2-yl)silylhexadec-11-en-2,15-diyn-4-ol.
| Compound Name | (E,8R,10S,13S,14R)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-16-tri(propan-2-yl)silylhexadec-11-en-2,15-diyn-4-ol |
|---|---|
| PubChem CID | 138980514 |
| Molecular Formula | C39H76O3Si3 |
| Molecular Weight | 677.29 g/mol |
| Exact Mass | 676.51 |
| IUPAC Name | (E,8R,10S,13S,14R)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-16-tri(propan-2-yl)silylhexadec-11-en-2,15-diyn-4-ol |
| SMILES | CC#CC(O)CCC[C@H](C[C@H](C)/C=C/[C@H](C)[C@H](C#C[Si](C(C)C)(C(C)C)C(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H76O3Si3/c1-20-22-35(40)23-21-24-36(41-43(16,17)38(10,11)12)29-33(8)25-26-34(9)37(42-44(18,19)39(13,14)15)27-28-45(30(2)3,31(4)5)32(6)7/h25-26,30-37,40H,21,23-24,29H2,1-19H3/b26-25+/t33-,34+,35?,36-,37+/m1/s1 |
| InChIKey | NERQGHNRZPJBQG-GARDQOKPSA-N |
| XLogP | 11.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.29 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|