C24H52O3SSi2 — CID 138980518
S-ethyl (3S,5R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylnonanethioate (PubChem CID 138980518) has the molecular formula C24H52O3SSi2 and a molecular weight of 476.92 g/mol. Its IUPAC name is S-ethyl (3S,5R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylnonanethioate.
| Compound Name | S-ethyl (3S,5R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylnonanethioate |
|---|---|
| PubChem CID | 138980518 |
| Molecular Formula | C24H52O3SSi2 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | S-ethyl (3S,5R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylnonanethioate |
| SMILES | CCSC(=O)C[C@@H](C)C[C@@H](CCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H52O3SSi2/c1-13-28-22(25)19-20(2)18-21(27-30(11,12)24(6,7)8)16-14-15-17-26-29(9,10)23(3,4)5/h20-21H,13-19H2,1-12H3/t20-,21+/m0/s1 |
| InChIKey | LWTYPRJDJOMGBY-LEWJYISDSA-N |
| XLogP | 8.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|