About (4-bromophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]diazene
(4-bromophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]diazene (PubChem CID 138980686) has the molecular formula C13H14BrF3N2
and a molecular weight of 335.17 g/mol. Its IUPAC name is (4-bromophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]diazene.
Molecular Properties
| Compound Name | (4-bromophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]diazene |
| PubChem CID | 138980686 |
| Molecular Formula | C13H14BrF3N2 |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | (4-bromophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]diazene |
| SMILES | FC(F)(F)[C@@H]1CCCC[C@H]1/N=N/c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H14BrF3N2/c14-9-5-7-10(8-6-9)18-19-12-4-2-1-3-11(12)13(15,16)17/h5-8,11-12H,1-4H2/b19-18+/t11-,12-/m1/s1 |
| InChIKey | OUCUJWPRMHRMAL-UTNNDRTLSA-N |
| XLogP | 5.65 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]diazene?
The IUPAC name of (4-bromophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]diazene (CID 138980686) is (4-bromophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]diazene.
What is the SMILES notation for (4-bromophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]diazene?
The canonical SMILES for (4-bromophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]diazene is FC(F)(F)[C@@H]1CCCC[C@H]1/N=N/c1ccc(Br)cc1.
What is the InChIKey of (4-bromophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]diazene?
The InChIKey is OUCUJWPRMHRMAL-UTNNDRTLSA-N. The full InChI is InChI=1S/C13H14BrF3N2/c14-9-5-7-10(8-6-9)18-19-12-4-2-1-3-11(12)13(15,16)17/h5-8,11-12H,1-4H2/b19-18+/t11-,12-/m1/s1.
What are the key properties of (4-bromophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]diazene?
(4-bromophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]diazene has a molecular weight of 335.17 g/mol, XLogP of 5.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]diazene is sourced from PubChem (CID 138980686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).