About 2-methoxy-N-[3,3,3-trifluoro-1-(4-methylphenyl)propyl]acetamide
2-methoxy-N-[3,3,3-trifluoro-1-(4-methylphenyl)propyl]acetamide (PubChem CID 138980687) has the molecular formula C13H16F3NO2
and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-methoxy-N-[3,3,3-trifluoro-1-(4-methylphenyl)propyl]acetamide.
Molecular Properties
| Compound Name | 2-methoxy-N-[3,3,3-trifluoro-1-(4-methylphenyl)propyl]acetamide |
| PubChem CID | 138980687 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-methoxy-N-[3,3,3-trifluoro-1-(4-methylphenyl)propyl]acetamide |
| SMILES | COCC(=O)NC(CC(F)(F)F)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H16F3NO2/c1-9-3-5-10(6-4-9)11(7-13(14,15)16)17-12(18)8-19-2/h3-6,11H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | OYOLOTYNDLLCIG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-N-[3,3,3-trifluoro-1-(4-methylphenyl)propyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-[3,3,3-trifluoro-1-(4-methylphenyl)propyl]acetamide?
The IUPAC name of 2-methoxy-N-[3,3,3-trifluoro-1-(4-methylphenyl)propyl]acetamide (CID 138980687) is 2-methoxy-N-[3,3,3-trifluoro-1-(4-methylphenyl)propyl]acetamide.
What is the SMILES notation for 2-methoxy-N-[3,3,3-trifluoro-1-(4-methylphenyl)propyl]acetamide?
The canonical SMILES for 2-methoxy-N-[3,3,3-trifluoro-1-(4-methylphenyl)propyl]acetamide is COCC(=O)NC(CC(F)(F)F)c1ccc(C)cc1.
What is the InChIKey of 2-methoxy-N-[3,3,3-trifluoro-1-(4-methylphenyl)propyl]acetamide?
The InChIKey is OYOLOTYNDLLCIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3NO2/c1-9-3-5-10(6-4-9)11(7-13(14,15)16)17-12(18)8-19-2/h3-6,11H,7-8H2,1-2H3,(H,17,18).
What are the key properties of 2-methoxy-N-[3,3,3-trifluoro-1-(4-methylphenyl)propyl]acetamide?
2-methoxy-N-[3,3,3-trifluoro-1-(4-methylphenyl)propyl]acetamide has a molecular weight of 275.27 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-[3,3,3-trifluoro-1-(4-methylphenyl)propyl]acetamide is sourced from PubChem (CID 138980687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).