C17H28F3NO3SSi — CID 138980759
N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutan-2-yl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 138980759) has the molecular formula C17H28F3NO3SSi and a molecular weight of 411.56 g/mol. Its IUPAC name is N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutan-2-yl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutan-2-yl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 138980759 |
| Molecular Formula | C17H28F3NO3SSi |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutan-2-yl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](CCc1ccccc1)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H28F3NO3SSi/c1-16(2,3)26(4,5)24-13-15(21-25(22,23)17(18,19)20)12-11-14-9-7-6-8-10-14/h6-10,15,21H,11-13H2,1-5H3/t15-/m0/s1 |
| InChIKey | VZWQIHPLMAAKRM-HNNXBMFYSA-N |
| XLogP | 4.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|