C24H31BFNO3 — CID 138980771
(5S)-N-benzyl-5-(4-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide (PubChem CID 138980771) has the molecular formula C24H31BFNO3 and a molecular weight of 411.33 g/mol. Its IUPAC name is (5S)-N-benzyl-5-(4-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide.
| Compound Name | (5S)-N-benzyl-5-(4-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide |
|---|---|
| PubChem CID | 138980771 |
| Molecular Formula | C24H31BFNO3 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | (5S)-N-benzyl-5-(4-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide |
| SMILES | CC1(C)OB([C@@H](CCCC(=O)NCc2ccccc2)c2ccc(F)cc2)OC1(C)C |
| InChI | InChI=1S/C24H31BFNO3/c1-23(2)24(3,4)30-25(29-23)21(19-13-15-20(26)16-14-19)11-8-12-22(28)27-17-18-9-6-5-7-10-18/h5-7,9-10,13-16,21H,8,11-12,17H2,1-4H3,(H,27,28)/t21-/m0/s1 |
| InChIKey | DGNIJZZWWDYHJY-NRFANRHFSA-N |
| XLogP | 5.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|