C16H24O4 — CID 138980828
ethyl (4S)-4-(2-ethoxy-2-oxoethyl)spiro[4.4]non-2-ene-2-carboxylate (PubChem CID 138980828) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is ethyl (4S)-4-(2-ethoxy-2-oxoethyl)spiro[4.4]non-2-ene-2-carboxylate.
| Compound Name | ethyl (4S)-4-(2-ethoxy-2-oxoethyl)spiro[4.4]non-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 138980828 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | ethyl (4S)-4-(2-ethoxy-2-oxoethyl)spiro[4.4]non-2-ene-2-carboxylate |
| SMILES | CCOC(=O)C[C@H]1C=C(C(=O)OCC)CC12CCCC2 |
| InChI | InChI=1S/C16H24O4/c1-3-19-14(17)10-13-9-12(15(18)20-4-2)11-16(13)7-5-6-8-16/h9,13H,3-8,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | KXFYAOPFTDGGSB-CYBMUJFWSA-N |
| XLogP | 3.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |