C14H20ClF3O6S — CID 138980889
cis-diethyl (3S,4S)-3-(chlorosulfonylmethyl)-4-(2,2,2-trifluoroethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 138980889) has the molecular formula C14H20ClF3O6S and a molecular weight of 408.82 g/mol. Its IUPAC name is cis-diethyl (3S,4S)-3-(chlorosulfonylmethyl)-4-(2,2,2-trifluoroethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | cis-diethyl (3S,4S)-3-(chlorosulfonylmethyl)-4-(2,2,2-trifluoroethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 138980889 |
| Molecular Formula | C14H20ClF3O6S |
| Molecular Weight | 408.82 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | cis-diethyl (3S,4S)-3-(chlorosulfonylmethyl)-4-(2,2,2-trifluoroethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H](CC(F)(F)F)[C@@H](CS(=O)(=O)Cl)C1 |
| InChI | InChI=1S/C14H20ClF3O6S/c1-3-23-11(19)13(12(20)24-4-2)5-9(7-14(16,17)18)10(6-13)8-25(15,21)22/h9-10H,3-8H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | JRJXOWKKKQJHCU-VHSXEESVSA-N |
| XLogP | 2.65 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.82 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|