C31H29F2NO4S — CID 138981023
[(4S)-3,3-difluoro-4-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]-4-phenylbut-1-en-2-yl] 4-methylbenzenesulfonate (PubChem CID 138981023) has the molecular formula C31H29F2NO4S and a molecular weight of 549.64 g/mol. Its IUPAC name is [(4S)-3,3-difluoro-4-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]-4-phenylbut-1-en-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(4S)-3,3-difluoro-4-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]-4-phenylbut-1-en-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 138981023 |
| Molecular Formula | C31H29F2NO4S |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | [(4S)-3,3-difluoro-4-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]-4-phenylbut-1-en-2-yl] 4-methylbenzenesulfonate |
| SMILES | C=C(OS(=O)(=O)c1ccc(C)cc1)C(F)(F)[C@@H](N[C@@H](c1ccccc1)[C@H](O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H29F2NO4S/c1-22-18-20-27(21-19-22)39(36,37)38-23(2)31(32,33)30(26-16-10-5-11-17-26)34-28(24-12-6-3-7-13-24)29(35)25-14-8-4-9-15-25/h3-21,28-30,34-35H,2H2,1H3/t28-,29+,30-/m0/s1 |
| InChIKey | WFNQEOAMNSVTFG-JBOQNHBVSA-N |
| XLogP | 6.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|