C33H31F2NO4S — CID 138981026
[(4S,5E)-3,3-difluoro-4-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]-6-phenylhexa-1,5-dien-2-yl] 4-methylbenzenesulfonate (PubChem CID 138981026) has the molecular formula C33H31F2NO4S and a molecular weight of 575.68 g/mol. Its IUPAC name is [(4S,5E)-3,3-difluoro-4-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]-6-phenylhexa-1,5-dien-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(4S,5E)-3,3-difluoro-4-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]-6-phenylhexa-1,5-dien-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 138981026 |
| Molecular Formula | C33H31F2NO4S |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | [(4S,5E)-3,3-difluoro-4-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]-6-phenylhexa-1,5-dien-2-yl] 4-methylbenzenesulfonate |
| SMILES | C=C(OS(=O)(=O)c1ccc(C)cc1)C(F)(F)[C@H](/C=C/c1ccccc1)N[C@@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C33H31F2NO4S/c1-24-18-21-29(22-19-24)41(38,39)40-25(2)33(34,35)30(23-20-26-12-6-3-7-13-26)36-31(27-14-8-4-9-15-27)32(37)28-16-10-5-11-17-28/h3-23,30-32,36-37H,2H2,1H3/b23-20+/t30-,31-,32+/m0/s1 |
| InChIKey | FGVYVYYPTSVFIP-ABOLSURGSA-N |
| XLogP | 7.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|