About N-(7,7,7-trifluoroheptyl)methanesulfonamide
N-(7,7,7-trifluoroheptyl)methanesulfonamide (PubChem CID 138981048) has the molecular formula C8H16F3NO2S
and a molecular weight of 247.28 g/mol. Its IUPAC name is N-(7,7,7-trifluoroheptyl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(7,7,7-trifluoroheptyl)methanesulfonamide |
| PubChem CID | 138981048 |
| Molecular Formula | C8H16F3NO2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-(7,7,7-trifluoroheptyl)methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCCCCC(F)(F)F |
| InChI | InChI=1S/C8H16F3NO2S/c1-15(13,14)12-7-5-3-2-4-6-8(9,10)11/h12H,2-7H2,1H3 |
| InChIKey | FYUXYLSTSVFFHE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(7,7,7-trifluoroheptyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7,7,7-trifluoroheptyl)methanesulfonamide?
The IUPAC name of N-(7,7,7-trifluoroheptyl)methanesulfonamide (CID 138981048) is N-(7,7,7-trifluoroheptyl)methanesulfonamide.
What is the SMILES notation for N-(7,7,7-trifluoroheptyl)methanesulfonamide?
The canonical SMILES for N-(7,7,7-trifluoroheptyl)methanesulfonamide is CS(=O)(=O)NCCCCCCC(F)(F)F.
What is the InChIKey of N-(7,7,7-trifluoroheptyl)methanesulfonamide?
The InChIKey is FYUXYLSTSVFFHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3NO2S/c1-15(13,14)12-7-5-3-2-4-6-8(9,10)11/h12H,2-7H2,1H3.
What are the key properties of N-(7,7,7-trifluoroheptyl)methanesulfonamide?
N-(7,7,7-trifluoroheptyl)methanesulfonamide has a molecular weight of 247.28 g/mol, XLogP of 2.05, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7,7,7-trifluoroheptyl)methanesulfonamide is sourced from PubChem (CID 138981048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).