About 4-(6-methoxynaphthalen-2-yl)-3-(trifluoromethylsulfonyl)-2H-[1]benzoselenolo[3,2-b]pyran
4-(6-methoxynaphthalen-2-yl)-3-(trifluoromethylsulfonyl)-2H-[1]benzoselenolo[3,2-b]pyran (PubChem CID 138981068) has the molecular formula C23H15F3O4SSe
and a molecular weight of 523.39 g/mol. Its IUPAC name is 4-(6-methoxynaphthalen-2-yl)-3-(trifluoromethylsulfonyl)-2H-[1]benzoselenolo[3,2-b]pyran.
Molecular Properties
| Compound Name | 4-(6-methoxynaphthalen-2-yl)-3-(trifluoromethylsulfonyl)-2H-[1]benzoselenolo[3,2-b]pyran |
| PubChem CID | 138981068 |
| Molecular Formula | C23H15F3O4SSe |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 523.98 |
| IUPAC Name | 4-(6-methoxynaphthalen-2-yl)-3-(trifluoromethylsulfonyl)-2H-[1]benzoselenolo[3,2-b]pyran |
| SMILES | COc1ccc2cc(C3=C(S(=O)(=O)C(F)(F)F)COc4c3[se]c3ccccc43)ccc2c1 |
| InChI | InChI=1S/C23H15F3O4SSe/c1-29-16-9-8-13-10-15(7-6-14(13)11-16)20-18(31(27,28)23(24,25)26)12-30-21-17-4-2-3-5-19(17)32-22(20)21/h2-11H,12H2,1H3 |
| InChIKey | MYGZGVCMIWXCPB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-methoxynaphthalen-2-yl)-3-(trifluoromethylsulfonyl)-2H-[1]benzoselenolo[3,2-b]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-methoxynaphthalen-2-yl)-3-(trifluoromethylsulfonyl)-2H-[1]benzoselenolo[3,2-b]pyran?
The IUPAC name of 4-(6-methoxynaphthalen-2-yl)-3-(trifluoromethylsulfonyl)-2H-[1]benzoselenolo[3,2-b]pyran (CID 138981068) is 4-(6-methoxynaphthalen-2-yl)-3-(trifluoromethylsulfonyl)-2H-[1]benzoselenolo[3,2-b]pyran.
What is the SMILES notation for 4-(6-methoxynaphthalen-2-yl)-3-(trifluoromethylsulfonyl)-2H-[1]benzoselenolo[3,2-b]pyran?
The canonical SMILES for 4-(6-methoxynaphthalen-2-yl)-3-(trifluoromethylsulfonyl)-2H-[1]benzoselenolo[3,2-b]pyran is COc1ccc2cc(C3=C(S(=O)(=O)C(F)(F)F)COc4c3[se]c3ccccc43)ccc2c1.
What is the InChIKey of 4-(6-methoxynaphthalen-2-yl)-3-(trifluoromethylsulfonyl)-2H-[1]benzoselenolo[3,2-b]pyran?
The InChIKey is MYGZGVCMIWXCPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15F3O4SSe/c1-29-16-9-8-13-10-15(7-6-14(13)11-16)20-18(31(27,28)23(24,25)26)12-30-21-17-4-2-3-5-19(17)32-22(20)21/h2-11H,12H2,1H3.
What are the key properties of 4-(6-methoxynaphthalen-2-yl)-3-(trifluoromethylsulfonyl)-2H-[1]benzoselenolo[3,2-b]pyran?
4-(6-methoxynaphthalen-2-yl)-3-(trifluoromethylsulfonyl)-2H-[1]benzoselenolo[3,2-b]pyran has a molecular weight of 523.39 g/mol, XLogP of 5.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-methoxynaphthalen-2-yl)-3-(trifluoromethylsulfonyl)-2H-[1]benzoselenolo[3,2-b]pyran is sourced from PubChem (CID 138981068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).