C27H24F2O — CID 138981192
(2S)-2-[(E,2S)-2,4-bis(4-fluorophenyl)but-3-enyl]-2-phenylcyclopentan-1-one (PubChem CID 138981192) has the molecular formula C27H24F2O and a molecular weight of 402.48 g/mol. Its IUPAC name is (2S)-2-[(E,2S)-2,4-bis(4-fluorophenyl)but-3-enyl]-2-phenylcyclopentan-1-one.
| Compound Name | (2S)-2-[(E,2S)-2,4-bis(4-fluorophenyl)but-3-enyl]-2-phenylcyclopentan-1-one |
|---|---|
| PubChem CID | 138981192 |
| Molecular Formula | C27H24F2O |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (2S)-2-[(E,2S)-2,4-bis(4-fluorophenyl)but-3-enyl]-2-phenylcyclopentan-1-one |
| SMILES | O=C1CCC[C@]1(C[C@@H](/C=C/c1ccc(F)cc1)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H24F2O/c28-24-14-9-20(10-15-24)8-11-22(21-12-16-25(29)17-13-21)19-27(18-4-7-26(27)30)23-5-2-1-3-6-23/h1-3,5-6,8-17,22H,4,7,18-19H2/b11-8+/t22-,27+/m1/s1 |
| InChIKey | PULUWIXCCNOOKR-PNCHUZJTSA-N |
| XLogP | 6.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |