C31H46O6Si — CID 138981354
tert-butyl-diphenyl-[(3S)-3-(3,4,5-trimethoxy-6-methyloxan-2-yl)oxyhex-5-enoxy]silane (PubChem CID 138981354) has the molecular formula C31H46O6Si and a molecular weight of 542.79 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(3S)-3-(3,4,5-trimethoxy-6-methyloxan-2-yl)oxyhex-5-enoxy]silane.
| Compound Name | tert-butyl-diphenyl-[(3S)-3-(3,4,5-trimethoxy-6-methyloxan-2-yl)oxyhex-5-enoxy]silane |
|---|---|
| PubChem CID | 138981354 |
| Molecular Formula | C31H46O6Si |
| Molecular Weight | 542.79 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | tert-butyl-diphenyl-[(3S)-3-(3,4,5-trimethoxy-6-methyloxan-2-yl)oxyhex-5-enoxy]silane |
| SMILES | C=CC[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC1OC(C)C(OC)C(OC)C1OC |
| InChI | InChI=1S/C31H46O6Si/c1-9-16-24(37-30-29(34-8)28(33-7)27(32-6)23(2)36-30)21-22-35-38(31(3,4)5,25-17-12-10-13-18-25)26-19-14-11-15-20-26/h9-15,17-20,23-24,27-30H,1,16,21-22H2,2-8H3/t23?,24-,27?,28?,29?,30?/m0/s1 |
| InChIKey | ODHAVBHPLODCPH-DYMVGOEYSA-N |
| XLogP | 4.70 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.79 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|