C30H68O4Si3 — CID 138981466
(3R,4R,5S,9S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-9-triethylsilyloxyundecan-1-ol (PubChem CID 138981466) has the molecular formula C30H68O4Si3 and a molecular weight of 577.13 g/mol. Its IUPAC name is (3R,4R,5S,9S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-9-triethylsilyloxyundecan-1-ol.
| Compound Name | (3R,4R,5S,9S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-9-triethylsilyloxyundecan-1-ol |
|---|---|
| PubChem CID | 138981466 |
| Molecular Formula | C30H68O4Si3 |
| Molecular Weight | 577.13 g/mol |
| Exact Mass | 576.44 |
| IUPAC Name | (3R,4R,5S,9S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-9-triethylsilyloxyundecan-1-ol |
| SMILES | CC[C@@H](CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](CCO)O[Si](C)(C)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C30H68O4Si3/c1-16-26(32-37(17-2,18-3)19-4)21-20-22-27(33-35(12,13)29(6,7)8)25(5)28(23-24-31)34-36(14,15)30(9,10)11/h25-28,31H,16-24H2,1-15H3/t25-,26+,27+,28-/m1/s1 |
| InChIKey | VDMRZCMHNDOFBN-WXIAYYLYSA-N |
| XLogP | 9.76 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.13 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|