C27H36O3S2Si — CID 138981470
methyl (E,5S)-5-[tert-butyl(diphenyl)silyl]oxy-6-(1,3-dithian-2-yl)hex-2-enoate (PubChem CID 138981470) has the molecular formula C27H36O3S2Si and a molecular weight of 500.80 g/mol. Its IUPAC name is methyl (E,5S)-5-[tert-butyl(diphenyl)silyl]oxy-6-(1,3-dithian-2-yl)hex-2-enoate.
| Compound Name | methyl (E,5S)-5-[tert-butyl(diphenyl)silyl]oxy-6-(1,3-dithian-2-yl)hex-2-enoate |
|---|---|
| PubChem CID | 138981470 |
| Molecular Formula | C27H36O3S2Si |
| Molecular Weight | 500.80 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | methyl (E,5S)-5-[tert-butyl(diphenyl)silyl]oxy-6-(1,3-dithian-2-yl)hex-2-enoate |
| SMILES | COC(=O)/C=C/C[C@@H](CC1SCCCS1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H36O3S2Si/c1-27(2,3)33(23-14-7-5-8-15-23,24-16-9-6-10-17-24)30-22(13-11-18-25(28)29-4)21-26-31-19-12-20-32-26/h5-11,14-18,22,26H,12-13,19-21H2,1-4H3/b18-11+/t22-/m0/s1 |
| InChIKey | YMUXICJVGXLZJV-VLBBBODESA-N |
| XLogP | 5.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.80 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|