C20H27NSi — CID 138981634
3-(5,5-dimethyl-10H-benzo[b][1]benzosilin-10-yl)-N,N-dimethylpropan-1-amine (PubChem CID 138981634) has the molecular formula C20H27NSi and a molecular weight of 309.53 g/mol. Its IUPAC name is 3-(5,5-dimethyl-10H-benzo[b][1]benzosilin-10-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(5,5-dimethyl-10H-benzo[b][1]benzosilin-10-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 138981634 |
| Molecular Formula | C20H27NSi |
| Molecular Weight | 309.53 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 3-(5,5-dimethyl-10H-benzo[b][1]benzosilin-10-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCC1c2ccccc2[Si](C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H27NSi/c1-21(2)15-9-12-16-17-10-5-7-13-19(17)22(3,4)20-14-8-6-11-18(16)20/h5-8,10-11,13-14,16H,9,12,15H2,1-4H3 |
| InChIKey | BGSLKZQVYNCUHN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|