C15H20O3 — CID 138981711
(1S,6S,8R,11R)-11-hydroxy-11-prop-2-enyltricyclo[6.3.1.01,6]dodecane-10,12-dione (PubChem CID 138981711) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1S,6S,8R,11R)-11-hydroxy-11-prop-2-enyltricyclo[6.3.1.01,6]dodecane-10,12-dione.
| Compound Name | (1S,6S,8R,11R)-11-hydroxy-11-prop-2-enyltricyclo[6.3.1.01,6]dodecane-10,12-dione |
|---|---|
| PubChem CID | 138981711 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1S,6S,8R,11R)-11-hydroxy-11-prop-2-enyltricyclo[6.3.1.01,6]dodecane-10,12-dione |
| SMILES | C=CC[C@]1(O)C(=O)C[C@H]2C[C@@H]3CCCC[C@]31C2=O |
| InChI | InChI=1S/C15H20O3/c1-2-6-15(18)12(16)9-10-8-11-5-3-4-7-14(11,15)13(10)17/h2,10-11,18H,1,3-9H2/t10-,11+,14-,15+/m1/s1 |
| InChIKey | OQEXJCWLWKARNK-BVIHXZOGSA-N |
| XLogP | 2.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|