C20H12S4 — CID 138981768
(6Z,16Z)-21,22,23,24-tetrathiapentacyclo[16.2.1.12,5.18,11.112,15]tetracosa-1(20),2,4,6,8,10,12,14,16,18-decaene (PubChem CID 138981768) has the molecular formula C20H12S4 and a molecular weight of 380.58 g/mol. Its IUPAC name is (6Z,16Z)-21,22,23,24-tetrathiapentacyclo[16.2.1.12,5.18,11.112,15]tetracosa-1(20),2,4,6,8,10,12,14,16,18-decaene.
| Compound Name | (6Z,16Z)-21,22,23,24-tetrathiapentacyclo[16.2.1.12,5.18,11.112,15]tetracosa-1(20),2,4,6,8,10,12,14,16,18-decaene |
|---|---|
| PubChem CID | 138981768 |
| Molecular Formula | C20H12S4 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | (6Z,16Z)-21,22,23,24-tetrathiapentacyclo[16.2.1.12,5.18,11.112,15]tetracosa-1(20),2,4,6,8,10,12,14,16,18-decaene |
| SMILES | C1=C\c2ccc(s2)-c2ccc(s2)/C=C\c2ccc(s2)-c2ccc/1s2 |
| InChI | InChI=1S/C20H12S4/c1-2-14-6-10-19(22-14)20-12-8-16(24-20)4-3-15-7-11-18(23-15)17-9-5-13(1)21-17/h1-12H/b2-1-,4-3-,13-1-,14-2-,15-3-,16-4-,18-17-,20-19- |
| InChIKey | MSROBQXQQZEQGQ-WGMILTDNSA-N |
| XLogP | 7.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |