About (4R)-4-propan-2-ylocta-1,7-diyn-3-one
(4R)-4-propan-2-ylocta-1,7-diyn-3-one (PubChem CID 138981836) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is (4R)-4-propan-2-ylocta-1,7-diyn-3-one.
Molecular Properties
| Compound Name | (4R)-4-propan-2-ylocta-1,7-diyn-3-one |
| PubChem CID | 138981836 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (4R)-4-propan-2-ylocta-1,7-diyn-3-one |
| SMILES | C#CCC[C@@H](C(=O)C#C)C(C)C |
| InChI | InChI=1S/C11H14O/c1-5-7-8-10(9(3)4)11(12)6-2/h1-2,9-10H,7-8H2,3-4H3/t10-/m1/s1 |
| InChIKey | FARPRIGCWFRSNG-SNVBAGLBSA-N |
| XLogP | 1.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-propan-2-ylocta-1,7-diyn-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-propan-2-ylocta-1,7-diyn-3-one?
The IUPAC name of (4R)-4-propan-2-ylocta-1,7-diyn-3-one (CID 138981836) is (4R)-4-propan-2-ylocta-1,7-diyn-3-one.
What is the SMILES notation for (4R)-4-propan-2-ylocta-1,7-diyn-3-one?
The canonical SMILES for (4R)-4-propan-2-ylocta-1,7-diyn-3-one is C#CCC[C@@H](C(=O)C#C)C(C)C.
What is the InChIKey of (4R)-4-propan-2-ylocta-1,7-diyn-3-one?
The InChIKey is FARPRIGCWFRSNG-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H14O/c1-5-7-8-10(9(3)4)11(12)6-2/h1-2,9-10H,7-8H2,3-4H3/t10-/m1/s1.
What are the key properties of (4R)-4-propan-2-ylocta-1,7-diyn-3-one?
(4R)-4-propan-2-ylocta-1,7-diyn-3-one has a molecular weight of 162.23 g/mol, XLogP of 1.87, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-propan-2-ylocta-1,7-diyn-3-one is sourced from PubChem (CID 138981836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).