About benzene;2H-1,3-benzothiazol-2-ide;yttrium
benzene;2H-1,3-benzothiazol-2-ide;yttrium (PubChem CID 138981943) has the molecular formula C13H9NSY-2
and a molecular weight of 300.20 g/mol. Its IUPAC name is benzene;2H-1,3-benzothiazol-2-ide;yttrium.
Molecular Properties
| Compound Name | benzene;2H-1,3-benzothiazol-2-ide;yttrium |
| PubChem CID | 138981943 |
| Molecular Formula | C13H9NSY-2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.95 |
| IUPAC Name | benzene;2H-1,3-benzothiazol-2-ide;yttrium |
| SMILES | [Y].[c-]1ccccc1.[c-]1nc2ccccc2s1 |
| InChI | InChI=1S/C7H4NS.C6H5.Y/c1-2-4-7-6(3-1)8-5-9-7;1-2-4-6-5-3-1;/h1-4H;1-5H;/q2*-1; |
| InChIKey | KGYPXVCGBGQTFT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzene;2H-1,3-benzothiazol-2-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;2H-1,3-benzothiazol-2-ide;yttrium?
The IUPAC name of benzene;2H-1,3-benzothiazol-2-ide;yttrium (CID 138981943) is benzene;2H-1,3-benzothiazol-2-ide;yttrium.
What is the SMILES notation for benzene;2H-1,3-benzothiazol-2-ide;yttrium?
The canonical SMILES for benzene;2H-1,3-benzothiazol-2-ide;yttrium is [Y].[c-]1ccccc1.[c-]1nc2ccccc2s1.
What is the InChIKey of benzene;2H-1,3-benzothiazol-2-ide;yttrium?
The InChIKey is KGYPXVCGBGQTFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4NS.C6H5.Y/c1-2-4-7-6(3-1)8-5-9-7;1-2-4-6-5-3-1;/h1-4H;1-5H;/q2*-1;.
What are the key properties of benzene;2H-1,3-benzothiazol-2-ide;yttrium?
benzene;2H-1,3-benzothiazol-2-ide;yttrium has a molecular weight of 300.20 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;2H-1,3-benzothiazol-2-ide;yttrium is sourced from PubChem (CID 138981943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).